C17H17Cl2N2O+ — CID 8877205
N-(2,4-dichlorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide (PubChem CID 8877205) has the molecular formula C17H17Cl2N2O+ and a molecular weight of 336.24 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide |
|---|---|
| PubChem CID | 8877205 |
| Molecular Formula | C17H17Cl2N2O+ |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide |
| SMILES | O=C(C[n+]1ccc2c(c1)CCCC2)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O/c18-14-5-6-16(15(19)9-14)20-17(22)11-21-8-7-12-3-1-2-4-13(12)10-21/h5-10H,1-4,11H2/p+1 |
| InChIKey | RMCNZIKARRDGOL-UHFFFAOYSA-O |
| XLogP | 3.80 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|