C16H21Cl2NO3S — CID 154754123
N-(2,4-dichlorophenyl)-2-(4,4-dimethylcyclohexyl)sulfonylacetamide (PubChem CID 154754123) has the molecular formula C16H21Cl2NO3S and a molecular weight of 378.32 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(4,4-dimethylcyclohexyl)sulfonylacetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(4,4-dimethylcyclohexyl)sulfonylacetamide |
|---|---|
| PubChem CID | 154754123 |
| Molecular Formula | C16H21Cl2NO3S |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(4,4-dimethylcyclohexyl)sulfonylacetamide |
| SMILES | CC1(C)CCC(S(=O)(=O)CC(=O)Nc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H21Cl2NO3S/c1-16(2)7-5-12(6-8-16)23(21,22)10-15(20)19-14-4-3-11(17)9-13(14)18/h3-4,9,12H,5-8,10H2,1-2H3,(H,19,20) |
| InChIKey | DWOZVVVUKDNEAP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |