C18H19ClFN2O+ — CID 8876903
(2R)-N-(2-chloro-4-fluorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide (PubChem CID 8876903) has the molecular formula C18H19ClFN2O+ and a molecular weight of 333.81 g/mol. Its IUPAC name is (2R)-N-(2-chloro-4-fluorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide.
| Compound Name | (2R)-N-(2-chloro-4-fluorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide |
|---|---|
| PubChem CID | 8876903 |
| Molecular Formula | C18H19ClFN2O+ |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2R)-N-(2-chloro-4-fluorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(F)cc1Cl)[n+]1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H18ClFN2O/c1-12(18(23)21-17-7-6-15(20)10-16(17)19)22-9-8-13-4-2-3-5-14(13)11-22/h6-12H,2-5H2,1H3/p+1/t12-/m1/s1 |
| InChIKey | IWYRDPZJWQJYBR-GFCCVEGCSA-O |
| XLogP | 3.85 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|