C18H20FN2O+ — CID 8876911
(2S)-N-(2-fluorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide (PubChem CID 8876911) has the molecular formula C18H20FN2O+ and a molecular weight of 299.37 g/mol. Its IUPAC name is (2S)-N-(2-fluorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide.
| Compound Name | (2S)-N-(2-fluorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide |
|---|---|
| PubChem CID | 8876911 |
| Molecular Formula | C18H20FN2O+ |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (2S)-N-(2-fluorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccccc1F)[n+]1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H19FN2O/c1-13(18(22)20-17-9-5-4-8-16(17)19)21-11-10-14-6-2-3-7-15(14)12-21/h4-5,8-13H,2-3,6-7H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | YSVBMANNZNOGBN-ZDUSSCGKSA-O |
| XLogP | 3.19 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|