C18H15Cl2N2O+ — CID 8828976
(2S)-N-(2,5-dichlorophenyl)-2-isoquinolin-2-ium-2-ylpropanamide (PubChem CID 8828976) has the molecular formula C18H15Cl2N2O+ and a molecular weight of 346.24 g/mol. Its IUPAC name is (2S)-N-(2,5-dichlorophenyl)-2-isoquinolin-2-ium-2-ylpropanamide.
| Compound Name | (2S)-N-(2,5-dichlorophenyl)-2-isoquinolin-2-ium-2-ylpropanamide |
|---|---|
| PubChem CID | 8828976 |
| Molecular Formula | C18H15Cl2N2O+ |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (2S)-N-(2,5-dichlorophenyl)-2-isoquinolin-2-ium-2-ylpropanamide |
| SMILES | C[C@@H](C(=O)Nc1cc(Cl)ccc1Cl)[n+]1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H14Cl2N2O/c1-12(18(23)21-17-10-15(19)6-7-16(17)20)22-9-8-13-4-2-3-5-14(13)11-22/h2-12H,1H3/p+1/t12-/m0/s1 |
| InChIKey | FSMLWGLWSAJSOX-LBPRGKRZSA-O |
| XLogP | 4.63 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|