C20H19N2O3+ — CID 8828960
(2R)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-isoquinolin-2-ium-2-ylpropanamide (PubChem CID 8828960) has the molecular formula C20H19N2O3+ and a molecular weight of 335.38 g/mol. Its IUPAC name is (2R)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-isoquinolin-2-ium-2-ylpropanamide.
| Compound Name | (2R)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-isoquinolin-2-ium-2-ylpropanamide |
|---|---|
| PubChem CID | 8828960 |
| Molecular Formula | C20H19N2O3+ |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (2R)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-isoquinolin-2-ium-2-ylpropanamide |
| SMILES | C[C@H](C(=O)Nc1ccc2c(c1)OCCO2)[n+]1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H18N2O3/c1-14(22-9-8-15-4-2-3-5-16(15)13-22)20(23)21-17-6-7-18-19(12-17)25-11-10-24-18/h2-9,12-14H,10-11H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | VYZZTPDZCFRITB-CQSZACIVSA-O |
| XLogP | 3.10 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|