C16H17N2O3+ — CID 8717718
(2R)-N-(1,3-benzodioxol-5-yl)-2-(2-methylpyridin-1-ium-1-yl)propanamide (PubChem CID 8717718) has the molecular formula C16H17N2O3+ and a molecular weight of 285.32 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-5-yl)-2-(2-methylpyridin-1-ium-1-yl)propanamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-(2-methylpyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 8717718 |
| Molecular Formula | C16H17N2O3+ |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-(2-methylpyridin-1-ium-1-yl)propanamide |
| SMILES | Cc1cccc[n+]1[C@H](C)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H16N2O3/c1-11-5-3-4-8-18(11)12(2)16(19)17-13-6-7-14-15(9-13)21-10-20-14/h3-9,12H,10H2,1-2H3/p+1/t12-/m1/s1 |
| InChIKey | RWCIVVZESQDPIB-GFCCVEGCSA-O |
| XLogP | 2.21 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|