C21H17Cl2N2O2+ — CID 8858648
(2R)-2-(4-benzoylpyridin-1-ium-1-yl)-N-(2,5-dichlorophenyl)propanamide (PubChem CID 8858648) has the molecular formula C21H17Cl2N2O2+ and a molecular weight of 400.29 g/mol. Its IUPAC name is (2R)-2-(4-benzoylpyridin-1-ium-1-yl)-N-(2,5-dichlorophenyl)propanamide.
| Compound Name | (2R)-2-(4-benzoylpyridin-1-ium-1-yl)-N-(2,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 8858648 |
| Molecular Formula | C21H17Cl2N2O2+ |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | (2R)-2-(4-benzoylpyridin-1-ium-1-yl)-N-(2,5-dichlorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cc(Cl)ccc1Cl)[n+]1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16Cl2N2O2/c1-14(21(27)24-19-13-17(22)7-8-18(19)23)25-11-9-16(10-12-25)20(26)15-5-3-2-4-6-15/h2-14H,1H3/p+1/t14-/m1/s1 |
| InChIKey | SZLKXTCUNDNFKL-CQSZACIVSA-O |
| XLogP | 4.71 |
| TPSA | 50.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|