C17H19Cl2N2O+ — CID 8861932
(2S)-N-(2,5-dichlorophenyl)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)propanamide (PubChem CID 8861932) has the molecular formula C17H19Cl2N2O+ and a molecular weight of 338.26 g/mol. Its IUPAC name is (2S)-N-(2,5-dichlorophenyl)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)propanamide.
| Compound Name | (2S)-N-(2,5-dichlorophenyl)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 8861932 |
| Molecular Formula | C17H19Cl2N2O+ |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (2S)-N-(2,5-dichlorophenyl)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)propanamide |
| SMILES | CCc1ccc(C)[n+]([C@@H](C)C(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O/c1-4-13-6-5-11(2)21(10-13)12(3)17(22)20-16-9-14(18)7-8-15(16)19/h5-10,12H,4H2,1-3H3/p+1/t12-/m0/s1 |
| InChIKey | LBXPDHPKSRANCZ-LBPRGKRZSA-O |
| XLogP | 4.35 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|