C19H20N3O+ — CID 8876923
(2R)-N-(3-cyanophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide (PubChem CID 8876923) has the molecular formula C19H20N3O+ and a molecular weight of 306.39 g/mol. Its IUPAC name is (2R)-N-(3-cyanophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide.
| Compound Name | (2R)-N-(3-cyanophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide |
|---|---|
| PubChem CID | 8876923 |
| Molecular Formula | C19H20N3O+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2R)-N-(3-cyanophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cccc(C#N)c1)[n+]1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H19N3O/c1-14(19(23)21-18-8-4-5-15(11-18)12-20)22-10-9-16-6-2-3-7-17(16)13-22/h4-5,8-11,13-14H,2-3,6-7H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | AUWRYCKPIXZPJX-CQSZACIVSA-O |
| XLogP | 2.92 |
| TPSA | 56.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|