C22H28N3O3S+ — CID 8876908
(2S)-N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide (PubChem CID 8876908) has the molecular formula C22H28N3O3S+ and a molecular weight of 414.55 g/mol. Its IUPAC name is (2S)-N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide.
| Compound Name | (2S)-N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide |
|---|---|
| PubChem CID | 8876908 |
| Molecular Formula | C22H28N3O3S+ |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (2S)-N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1)[n+]1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H27N3O3S/c1-17(24-15-12-18-6-2-3-7-19(18)16-24)22(26)23-20-8-10-21(11-9-20)29(27,28)25-13-4-5-14-25/h8-12,15-17H,2-7,13-14H2,1H3/p+1/t17-/m0/s1 |
| InChIKey | FCHOBHJQXLVRSE-KRWDZBQOSA-O |
| XLogP | 2.84 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|