C21H19ClFN2O+ — CID 8859904
(2R)-2-(4-benzylpyridin-1-ium-1-yl)-N-(2-chloro-4-fluorophenyl)propanamide (PubChem CID 8859904) has the molecular formula C21H19ClFN2O+ and a molecular weight of 369.85 g/mol. Its IUPAC name is (2R)-2-(4-benzylpyridin-1-ium-1-yl)-N-(2-chloro-4-fluorophenyl)propanamide.
| Compound Name | (2R)-2-(4-benzylpyridin-1-ium-1-yl)-N-(2-chloro-4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 8859904 |
| Molecular Formula | C21H19ClFN2O+ |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (2R)-2-(4-benzylpyridin-1-ium-1-yl)-N-(2-chloro-4-fluorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(F)cc1Cl)[n+]1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18ClFN2O/c1-15(21(26)24-20-8-7-18(23)14-19(20)22)25-11-9-17(10-12-25)13-16-5-3-2-4-6-16/h2-12,14-15H,13H2,1H3/p+1/t15-/m1/s1 |
| InChIKey | RRBJWONGNKTVAR-OAHLLOKOSA-O |
| XLogP | 4.56 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|