C18H19ClFNO — CID 25477648
(2R,3S)-N-(2-chloro-4-fluorophenyl)-3-methyl-2-phenylpentanamide (PubChem CID 25477648) has the molecular formula C18H19ClFNO and a molecular weight of 319.81 g/mol. Its IUPAC name is (2R,3S)-N-(2-chloro-4-fluorophenyl)-3-methyl-2-phenylpentanamide.
| Compound Name | (2R,3S)-N-(2-chloro-4-fluorophenyl)-3-methyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 25477648 |
| Molecular Formula | C18H19ClFNO |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (2R,3S)-N-(2-chloro-4-fluorophenyl)-3-methyl-2-phenylpentanamide |
| SMILES | CC[C@H](C)[C@@H](C(=O)Nc1ccc(F)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H19ClFNO/c1-3-12(2)17(13-7-5-4-6-8-13)18(22)21-16-10-9-14(20)11-15(16)19/h4-12,17H,3H2,1-2H3,(H,21,22)/t12-,17+/m0/s1 |
| InChIKey | ZUTDMFDOKVEPBE-YVEFUNNKSA-N |
| XLogP | 5.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |