C21H24ClFN2O — CID 55478369
N-(2-chloro-4-fluorophenyl)-2-[(1-phenylcyclopentyl)methylamino]propanamide (PubChem CID 55478369) has the molecular formula C21H24ClFN2O and a molecular weight of 374.89 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-[(1-phenylcyclopentyl)methylamino]propanamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-[(1-phenylcyclopentyl)methylamino]propanamide |
|---|---|
| PubChem CID | 55478369 |
| Molecular Formula | C21H24ClFN2O |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-[(1-phenylcyclopentyl)methylamino]propanamide |
| SMILES | CC(NCC1(c2ccccc2)CCCC1)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H24ClFN2O/c1-15(20(26)25-19-10-9-17(23)13-18(19)22)24-14-21(11-5-6-12-21)16-7-3-2-4-8-16/h2-4,7-10,13,15,24H,5-6,11-12,14H2,1H3,(H,25,26) |
| InChIKey | ADLBUJCCEMOOAW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |