C17H17ClNO+ — CID 8877072
1-(4-chlorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone (PubChem CID 8877072) has the molecular formula C17H17ClNO+ and a molecular weight of 286.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone |
|---|---|
| PubChem CID | 8877072 |
| Molecular Formula | C17H17ClNO+ |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone |
| SMILES | O=C(C[n+]1ccc2c(c1)CCCC2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClNO/c18-16-7-5-14(6-8-16)17(20)12-19-10-9-13-3-1-2-4-15(13)11-19/h5-11H,1-4,12H2/q+1 |
| InChIKey | OTWLGBIUQRHYFN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|