C15H18N3O2+ — CID 8876832
N-(5-methyl-1,2-oxazol-3-yl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide (PubChem CID 8876832) has the molecular formula C15H18N3O2+ and a molecular weight of 272.33 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide |
|---|---|
| PubChem CID | 8876832 |
| Molecular Formula | C15H18N3O2+ |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide |
| SMILES | Cc1cc(NC(=O)C[n+]2ccc3c(c2)CCCC3)no1 |
| InChI | InChI=1S/C15H17N3O2/c1-11-8-14(17-20-11)16-15(19)10-18-7-6-12-4-2-3-5-13(12)9-18/h6-9H,2-5,10H2,1H3/p+1 |
| InChIKey | BWOSRENOZNRGMR-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 59.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|