C19H26N3O2+ — CID 8831921
1-[2-(1-adamantylmethylamino)-2-oxoethyl]pyridin-1-ium-3-carboxamide (PubChem CID 8831921) has the molecular formula C19H26N3O2+ and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-[2-(1-adamantylmethylamino)-2-oxoethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-(1-adamantylmethylamino)-2-oxoethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 8831921 |
| Molecular Formula | C19H26N3O2+ |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-[2-(1-adamantylmethylamino)-2-oxoethyl]pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1ccc[n+](CC(=O)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H25N3O2/c20-18(24)16-2-1-3-22(10-16)11-17(23)21-12-19-7-13-4-14(8-19)6-15(5-13)9-19/h1-3,10,13-15H,4-9,11-12H2,(H2-,20,21,23,24)/p+1 |
| InChIKey | SSBOORPBRCMBKG-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|