C15H17NO3S2 — CID 6995921
1-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-methyl-1,3-benzothiazol-2-ylidene)propan-2-one (PubChem CID 6995921) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-methyl-1,3-benzothiazol-2-ylidene)propan-2-one.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-methyl-1,3-benzothiazol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 6995921 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-methyl-1,3-benzothiazol-2-ylidene)propan-2-one |
| SMILES | CN1C(=CC(=O)C[C@H]2CCS(=O)(=O)C2)Sc2ccccc21 |
| InChI | InChI=1S/C15H17NO3S2/c1-16-13-4-2-3-5-14(13)20-15(16)9-12(17)8-11-6-7-21(18,19)10-11/h2-5,9,11H,6-8,10H2,1H3/t11-/m1/s1 |
| InChIKey | WEDPLPVXKOIWTO-LLVKDONJSA-N |
| XLogP | 2.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|