C31H31N2S+ — CID 2312192
3-benzyl-2-[[2,6-dimethyl-1-(4-propan-2-ylphenyl)pyridin-1-ium-4-yl]methylidene]-1,3-benzothiazole (PubChem CID 2312192) has the molecular formula C31H31N2S+ and a molecular weight of 463.67 g/mol. Its IUPAC name is 3-benzyl-2-[[2,6-dimethyl-1-(4-propan-2-ylphenyl)pyridin-1-ium-4-yl]methylidene]-1,3-benzothiazole.
| Compound Name | 3-benzyl-2-[[2,6-dimethyl-1-(4-propan-2-ylphenyl)pyridin-1-ium-4-yl]methylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 2312192 |
| Molecular Formula | C31H31N2S+ |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 3-benzyl-2-[[2,6-dimethyl-1-(4-propan-2-ylphenyl)pyridin-1-ium-4-yl]methylidene]-1,3-benzothiazole |
| SMILES | Cc1cc(C=C2Sc3ccccc3N2Cc2ccccc2)cc(C)[n+]1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C31H31N2S/c1-22(2)27-14-16-28(17-15-27)33-23(3)18-26(19-24(33)4)20-31-32(21-25-10-6-5-7-11-25)29-12-8-9-13-30(29)34-31/h5-20,22H,21H2,1-4H3/q+1 |
| InChIKey | CWFZCAIKSQAMPL-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|