C17H13ClFIN2S2 — CID 134101046
2-[(Z)-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]-6-fluoro-3-methyl-1,3-benzothiazol-3-ium iodide (PubChem CID 134101046) has the molecular formula C17H13ClFIN2S2 and a molecular weight of 490.79 g/mol. Its IUPAC name is 2-[(Z)-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]-6-fluoro-3-methyl-1,3-benzothiazol-3-ium iodide.
| Compound Name | 2-[(Z)-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]-6-fluoro-3-methyl-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 134101046 |
| Molecular Formula | C17H13ClFIN2S2 |
| Molecular Weight | 490.79 g/mol |
| Exact Mass | 489.92 |
| IUPAC Name | 2-[(Z)-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)methyl]-6-fluoro-3-methyl-1,3-benzothiazol-3-ium iodide |
| SMILES | CN1/C(=C/c2sc3cc(F)ccc3[n+]2C)Sc2ccc(Cl)cc21.[I-] |
| InChI | InChI=1S/C17H13ClFN2S2.HI/c1-20-12-5-4-11(19)8-15(12)23-16(20)9-17-21(2)13-7-10(18)3-6-14(13)22-17;/h3-9H,1-2H3;1H/q+1;/p-1 |
| InChIKey | PMOWVDQHIZVYKG-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.79 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|