C19H24N2OPS+ — CID 71230453
3-(3-dimethylphosphorylpropyl)-2-[(1-methylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole (PubChem CID 71230453) has the molecular formula C19H24N2OPS+ and a molecular weight of 359.46 g/mol. Its IUPAC name is 3-(3-dimethylphosphorylpropyl)-2-[(1-methylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole.
| Compound Name | 3-(3-dimethylphosphorylpropyl)-2-[(1-methylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 71230453 |
| Molecular Formula | C19H24N2OPS+ |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-(3-dimethylphosphorylpropyl)-2-[(1-methylpyridin-1-ium-4-yl)methylidene]-1,3-benzothiazole |
| SMILES | C[n+]1ccc(C=C2Sc3ccccc3N2CCCP(C)(C)=O)cc1 |
| InChI | InChI=1S/C19H24N2OPS/c1-20-12-9-16(10-13-20)15-19-21(11-6-14-23(2,3)22)17-7-4-5-8-18(17)24-19/h4-5,7-10,12-13,15H,6,11,14H2,1-3H3/q+1 |
| InChIKey | WXIWIFWYGAXYBM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|