C24H35N3O3PS+ — CID 76645057
2-[4-[[3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazol-2-ylidene]methyl]pyridin-1-ium-1-yl]-N,N-dimethylethanamine (PubChem CID 76645057) has the molecular formula C24H35N3O3PS+ and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-[4-[[3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazol-2-ylidene]methyl]pyridin-1-ium-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[[3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazol-2-ylidene]methyl]pyridin-1-ium-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 76645057 |
| Molecular Formula | C24H35N3O3PS+ |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-[4-[[3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazol-2-ylidene]methyl]pyridin-1-ium-1-yl]-N,N-dimethylethanamine |
| SMILES | CCOP(=O)(CCCN1C(=Cc2cc[n+](CCN(C)C)cc2)Sc2ccccc21)OCC |
| InChI | InChI=1S/C24H35N3O3PS/c1-5-29-31(28,30-6-2)19-9-14-27-22-10-7-8-11-23(22)32-24(27)20-21-12-15-26(16-13-21)18-17-25(3)4/h7-8,10-13,15-16,20H,5-6,9,14,17-19H2,1-4H3/q+1 |
| InChIKey | DKYGAVRKUFIZGF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 45.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|