C18H22N2OS — CID 18847
View drug profile → methopromazine3-(2-methoxyphenothiazin-10-yl)-N,N-dimethylpropan-1-amine (PubChem CID 18847) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-(2-methoxyphenothiazin-10-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-methoxyphenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 18847 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-(2-methoxyphenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc2c(c1)N(CCCN(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C18H22N2OS/c1-19(2)11-6-12-20-15-7-4-5-8-17(15)22-18-10-9-14(21-3)13-16(18)20/h4-5,7-10,13H,6,11-12H2,1-3H3 |
| InChIKey | BRABPYPSZVCCLR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |