C20H25N3OS — CID 10570197
3-[2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenothiazin-10-yl]-N,N-dimethylpropan-1-amine (PubChem CID 10570197) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is 3-[2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenothiazin-10-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenothiazin-10-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 10570197 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-[2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenothiazin-10-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CO/N=C(\C)c1ccc2c(c1)N(CCCN(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C20H25N3OS/c1-15(21-24-4)16-10-11-20-18(14-16)23(13-7-12-22(2)3)17-8-5-6-9-19(17)25-20/h5-6,8-11,14H,7,12-13H2,1-4H3/b21-15+ |
| InChIKey | NUKJNORVGLOXBS-RCCKNPSSSA-N |
| XLogP | 4.61 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|