C19H22N2OS — CID 71312308
1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]ethanone (PubChem CID 71312308) has the molecular formula C19H22N2OS and a molecular weight of 332.50 g/mol. Its IUPAC name is 1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]ethanone.
| Compound Name | 1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]ethanone |
|---|---|
| PubChem CID | 71312308 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]ethanone |
| SMILES | [2H]C([2H])([2H])N(CCCN1c2ccccc2Sc2ccc(C(C)=O)cc21)C([2H])([2H])[2H] |
| InChI | InChI=1S/C19H22N2OS/c1-14(22)15-9-10-19-17(13-15)21(12-6-11-20(2)3)16-7-4-5-8-18(16)23-19/h4-5,7-10,13H,6,11-12H2,1-3H3/i2D3,3D3 |
| InChIKey | NOSIYYJFMPDDSA-XERRXZQWSA-N |
| XLogP | 4.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |