C17H20Cl2N2OS — CID 139024765
10-[3-[bis(trideuteriomethyl)amino]propyl]-8-chlorophenothiazin-3-ol;hydrochloride (PubChem CID 139024765) has the molecular formula C17H20Cl2N2OS and a molecular weight of 377.37 g/mol. Its IUPAC name is 10-[3-[bis(trideuteriomethyl)amino]propyl]-8-chlorophenothiazin-3-ol;hydrochloride.
| Compound Name | 10-[3-[bis(trideuteriomethyl)amino]propyl]-8-chlorophenothiazin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 139024765 |
| Molecular Formula | C17H20Cl2N2OS |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 10-[3-[bis(trideuteriomethyl)amino]propyl]-8-chlorophenothiazin-3-ol;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])N(CCCN1c2ccc(O)cc2Sc2ccc(Cl)cc21)C([2H])([2H])[2H] |
| InChI | InChI=1S/C17H19ClN2OS.ClH/c1-19(2)8-3-9-20-14-6-5-13(21)11-17(14)22-16-7-4-12(18)10-15(16)20;/h4-7,10-11,21H,3,8-9H2,1-2H3;1H/i1D3,2D3; |
| InChIKey | OTIORHLXOLCOAV-TXHXQZCNSA-N |
| XLogP | 5.02 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |