C19H21ClN2 — CID 162641277
3-(2-chlorobenzo[b][1]benzazepin-11-yl)-N,N-bis(trideuteriomethyl)propan-1-amine (PubChem CID 162641277) has the molecular formula C19H21ClN2 and a molecular weight of 318.88 g/mol. Its IUPAC name is 3-(2-chlorobenzo[b][1]benzazepin-11-yl)-N,N-bis(trideuteriomethyl)propan-1-amine.
| Compound Name | 3-(2-chlorobenzo[b][1]benzazepin-11-yl)-N,N-bis(trideuteriomethyl)propan-1-amine |
|---|---|
| PubChem CID | 162641277 |
| Molecular Formula | C19H21ClN2 |
| Molecular Weight | 318.88 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-(2-chlorobenzo[b][1]benzazepin-11-yl)-N,N-bis(trideuteriomethyl)propan-1-amine |
| SMILES | [2H]C([2H])([2H])N(CCCN1c2ccccc2C=Cc2ccc(Cl)cc21)C([2H])([2H])[2H] |
| InChI | InChI=1S/C19H21ClN2/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22/h3-4,6-11,14H,5,12-13H2,1-2H3/i1D3,2D3 |
| InChIKey | VSKOGDPXBVMJCT-WFGJKAKNSA-N |
| XLogP | 4.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.88 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|