C20H24N2S — CID 154324272
N,N-dimethyl-3-(2-methylsulfanylbenzo[b][1]benzazepin-11-yl)propan-1-amine (PubChem CID 154324272) has the molecular formula C20H24N2S and a molecular weight of 324.49 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-methylsulfanylbenzo[b][1]benzazepin-11-yl)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(2-methylsulfanylbenzo[b][1]benzazepin-11-yl)propan-1-amine |
|---|---|
| PubChem CID | 154324272 |
| Molecular Formula | C20H24N2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N,N-dimethyl-3-(2-methylsulfanylbenzo[b][1]benzazepin-11-yl)propan-1-amine |
| SMILES | CSc1ccc2c(c1)N(CCCN(C)C)c1ccccc1C=C2 |
| InChI | InChI=1S/C20H24N2S/c1-21(2)13-6-14-22-19-8-5-4-7-16(19)9-10-17-11-12-18(23-3)15-20(17)22/h4-5,7-12,15H,6,13-14H2,1-3H3 |
| InChIKey | CRNVMYBSYWTHLB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|