C17H19ClN2O2S — CID 12519492
8-chloro-10-[3-(dimethylamino)propyl]phenothiazine-1,3-diol (PubChem CID 12519492) has the molecular formula C17H19ClN2O2S and a molecular weight of 350.87 g/mol. Its IUPAC name is 8-chloro-10-[3-(dimethylamino)propyl]phenothiazine-1,3-diol.
| Compound Name | 8-chloro-10-[3-(dimethylamino)propyl]phenothiazine-1,3-diol |
|---|---|
| PubChem CID | 12519492 |
| Molecular Formula | C17H19ClN2O2S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 8-chloro-10-[3-(dimethylamino)propyl]phenothiazine-1,3-diol |
| SMILES | CN(C)CCCN1c2cc(Cl)ccc2Sc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C17H19ClN2O2S/c1-19(2)6-3-7-20-13-8-11(18)4-5-15(13)23-16-10-12(21)9-14(22)17(16)20/h4-5,8-10,21-22H,3,6-7H2,1-2H3 |
| InChIKey | BBWSVTCVXZFMQE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |