C17H21IN2S — CID 23622918
N,N-dimethyl-2-phenothiazin-10-ylethanamine;iodomethane (PubChem CID 23622918) has the molecular formula C17H21IN2S and a molecular weight of 412.34 g/mol. Its IUPAC name is N,N-dimethyl-2-phenothiazin-10-ylethanamine;iodomethane.
| Compound Name | N,N-dimethyl-2-phenothiazin-10-ylethanamine;iodomethane |
|---|---|
| PubChem CID | 23622918 |
| Molecular Formula | C17H21IN2S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | N,N-dimethyl-2-phenothiazin-10-ylethanamine;iodomethane |
| SMILES | CI.CN(C)CCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C16H18N2S.CH3I/c1-17(2)11-12-18-13-7-3-5-9-15(13)19-16-10-6-4-8-14(16)18;1-2/h3-10H,11-12H2,1-2H3;1H3 |
| InChIKey | SDXVHUOOQCEIPG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|