C19H25N2OS+ — CID 6919170
[(2S)-3-(2-methoxyphenothiazin-10-yl)-2-methylpropyl]-dimethylazanium (PubChem CID 6919170) has the molecular formula C19H25N2OS+ and a molecular weight of 329.49 g/mol. Its IUPAC name is [(2S)-3-(2-methoxyphenothiazin-10-yl)-2-methylpropyl]-dimethylazanium.
| Compound Name | [(2S)-3-(2-methoxyphenothiazin-10-yl)-2-methylpropyl]-dimethylazanium |
|---|---|
| PubChem CID | 6919170 |
| Molecular Formula | C19H25N2OS+ |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | [(2S)-3-(2-methoxyphenothiazin-10-yl)-2-methylpropyl]-dimethylazanium |
| SMILES | COc1ccc2c(c1)N(C[C@H](C)C[NH+](C)C)c1ccccc1S2 |
| InChI | InChI=1S/C19H24N2OS/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)23-19-10-9-15(22-4)11-17(19)21/h5-11,14H,12-13H2,1-4H3/p+1/t14-/m1/s1 |
| InChIKey | VRQVVMDWGGWHTJ-CQSZACIVSA-O |
| XLogP | 3.08 |
| TPSA | 16.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |