C28H35N2O3PS — CID 157457778
2-[(1-benzylpyridin-1-ium-4-yl)methylidene]-3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazole;carbanide (PubChem CID 157457778) has the molecular formula C28H35N2O3PS and a molecular weight of 510.64 g/mol. Its IUPAC name is 2-[(1-benzylpyridin-1-ium-4-yl)methylidene]-3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazole;carbanide.
| Compound Name | 2-[(1-benzylpyridin-1-ium-4-yl)methylidene]-3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazole;carbanide |
|---|---|
| PubChem CID | 157457778 |
| Molecular Formula | C28H35N2O3PS |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 2-[(1-benzylpyridin-1-ium-4-yl)methylidene]-3-(3-diethoxyphosphorylpropyl)-1,3-benzothiazole;carbanide |
| SMILES | CCOP(=O)(CCCN1C(=Cc2cc[n+](Cc3ccccc3)cc2)Sc2ccccc21)OCC.[CH3-] |
| InChI | InChI=1S/C27H32N2O3PS.CH3/c1-3-31-33(30,32-4-2)20-10-17-29-25-13-8-9-14-26(25)34-27(29)21-23-15-18-28(19-16-23)22-24-11-6-5-7-12-24;/h5-9,11-16,18-19,21H,3-4,10,17,20,22H2,1-2H3;1H3/q+1;-1 |
| InChIKey | BTOJCBHVUPKJDW-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|