C21H19Cl2N2O2+ — CID 177469071
(2E)-5-chloro-2-[(2E)-2-[(5-chloro-3-methyl-1,3-benzoxazol-3-ium-2-yl)methylidene]butylidene]-3-methyl-1,3-benzoxazole (PubChem CID 177469071) has the molecular formula C21H19Cl2N2O2+ and a molecular weight of 402.30 g/mol. Its IUPAC name is (2E)-5-chloro-2-[(2E)-2-[(5-chloro-3-methyl-1,3-benzoxazol-3-ium-2-yl)methylidene]butylidene]-3-methyl-1,3-benzoxazole.
| Compound Name | (2E)-5-chloro-2-[(2E)-2-[(5-chloro-3-methyl-1,3-benzoxazol-3-ium-2-yl)methylidene]butylidene]-3-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 177469071 |
| Molecular Formula | C21H19Cl2N2O2+ |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | (2E)-5-chloro-2-[(2E)-2-[(5-chloro-3-methyl-1,3-benzoxazol-3-ium-2-yl)methylidene]butylidene]-3-methyl-1,3-benzoxazole |
| SMILES | CCC(=C\c1oc2ccc(Cl)cc2[n+]1C)/C=C1/Oc2ccc(Cl)cc2N1C |
| InChI | InChI=1S/C21H19Cl2N2O2/c1-4-13(9-20-24(2)16-11-14(22)5-7-18(16)26-20)10-21-25(3)17-12-15(23)6-8-19(17)27-21/h5-12H,4H2,1-3H3/q+1 |
| InChIKey | YSQCQJICXIQHQJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 29.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|