C30H28ClN3O4S — CID 59112754
2-[4-[2-[(E,3Z)-3-(5-chloro-3-methyl-1,3-benzoxazol-2-ylidene)-2-methylprop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium-5-yl]-N-methylanilino]-3-sulfanylpropanoate (PubChem CID 59112754) has the molecular formula C30H28ClN3O4S and a molecular weight of 562.09 g/mol. Its IUPAC name is 2-[4-[2-[(E,3Z)-3-(5-chloro-3-methyl-1,3-benzoxazol-2-ylidene)-2-methylprop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium-5-yl]-N-methylanilino]-3-sulfanylpropanoate.
| Compound Name | 2-[4-[2-[(E,3Z)-3-(5-chloro-3-methyl-1,3-benzoxazol-2-ylidene)-2-methylprop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium-5-yl]-N-methylanilino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 59112754 |
| Molecular Formula | C30H28ClN3O4S |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 2-[4-[2-[(E,3Z)-3-(5-chloro-3-methyl-1,3-benzoxazol-2-ylidene)-2-methylprop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium-5-yl]-N-methylanilino]-3-sulfanylpropanoate |
| SMILES | CC(/C=C1\Oc2ccc(Cl)cc2N1C)=C\c1oc2ccc(-c3ccc(N(C)C(CS)C(=O)[O-])cc3)cc2[n+]1C |
| InChI | InChI=1S/C30H28ClN3O4S/c1-18(14-29-34(4)24-16-21(31)8-12-27(24)38-29)13-28-33(3)23-15-20(7-11-26(23)37-28)19-5-9-22(10-6-19)32(2)25(17-39)30(35)36/h5-16,25H,17H2,1-4H3,(H-,35,36,39) |
| InChIKey | WMGULRUUHMURRC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|