C24H25ClN2O8S2 — CID 91469511
[5-chloro-2-[2-[[5-methyl-3-(sulfomethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-1,3-benzoxazol-3-ium-3-yl]methanesulfonate;ethene (PubChem CID 91469511) has the molecular formula C24H25ClN2O8S2 and a molecular weight of 569.06 g/mol. Its IUPAC name is [5-chloro-2-[2-[[5-methyl-3-(sulfomethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-1,3-benzoxazol-3-ium-3-yl]methanesulfonate;ethene.
| Compound Name | [5-chloro-2-[2-[[5-methyl-3-(sulfomethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-1,3-benzoxazol-3-ium-3-yl]methanesulfonate;ethene |
|---|---|
| PubChem CID | 91469511 |
| Molecular Formula | C24H25ClN2O8S2 |
| Molecular Weight | 569.06 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | [5-chloro-2-[2-[[5-methyl-3-(sulfomethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-1,3-benzoxazol-3-ium-3-yl]methanesulfonate;ethene |
| SMILES | C=C.CCC(=Cc1oc2ccc(Cl)cc2[n+]1CS(=O)(=O)[O-])C=C1Oc2ccc(C)cc2N1CS(=O)(=O)O |
| InChI | InChI=1S/C22H21ClN2O8S2.C2H4/c1-3-15(9-21-24(12-34(26,27)28)17-8-14(2)4-6-19(17)32-21)10-22-25(13-35(29,30)31)18-11-16(23)5-7-20(18)33-22;1-2/h4-11H,3,12-13H2,1-2H3,(H-,26,27,28,29,30,31);1-2H2 |
| InChIKey | XVXWZNIZOJADMY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.06 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|