C19H15BrClN2O7S4- — CID 59893197
[(2E)-2-[(2Z)-2-[[5-bromo-1-(sulfonatomethyl)thieno[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]butylidene]-5-chloro-1,3-benzoxazol-3-yl]methanesulfonate (PubChem CID 59893197) has the molecular formula C19H15BrClN2O7S4- and a molecular weight of 626.96 g/mol. Its IUPAC name is [(2E)-2-[(2Z)-2-[[5-bromo-1-(sulfonatomethyl)thieno[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]butylidene]-5-chloro-1,3-benzoxazol-3-yl]methanesulfonate.
| Compound Name | [(2E)-2-[(2Z)-2-[[5-bromo-1-(sulfonatomethyl)thieno[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]butylidene]-5-chloro-1,3-benzoxazol-3-yl]methanesulfonate |
|---|---|
| PubChem CID | 59893197 |
| Molecular Formula | C19H15BrClN2O7S4- |
| Molecular Weight | 626.96 g/mol |
| Exact Mass | 624.86 |
| IUPAC Name | [(2E)-2-[(2Z)-2-[[5-bromo-1-(sulfonatomethyl)thieno[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]butylidene]-5-chloro-1,3-benzoxazol-3-yl]methanesulfonate |
| SMILES | CCC(=C/c1sc2sc(Br)cc2[n+]1CS(=O)(=O)[O-])/C=C1/Oc2ccc(Cl)cc2N1CS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H16BrClN2O7S4/c1-2-11(6-18-23(10-34(27,28)29)14-8-16(20)31-19(14)32-18)5-17-22(9-33(24,25)26)13-7-12(21)3-4-15(13)30-17/h3-8H,2,9-10H2,1H3,(H-,24,25,26,27,28,29)/p-1 |
| InChIKey | YHPSTJQTDXUHKA-UHFFFAOYSA-M |
| XLogP | 4.21 |
| TPSA | 130.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.96 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|