C27H22ClN2O8S3+ — CID 72612159
[2-[2-[[5-chloro-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-[1]benzofuro[2,3-f][1,3]benzoxazol-1-yl]methanesulfonic acid (PubChem CID 72612159) has the molecular formula C27H22ClN2O8S3+ and a molecular weight of 634.13 g/mol. Its IUPAC name is [2-[2-[[5-chloro-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-[1]benzofuro[2,3-f][1,3]benzoxazol-1-yl]methanesulfonic acid.
| Compound Name | [2-[2-[[5-chloro-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-[1]benzofuro[2,3-f][1,3]benzoxazol-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 72612159 |
| Molecular Formula | C27H22ClN2O8S3+ |
| Molecular Weight | 634.13 g/mol |
| Exact Mass | 633.02 |
| IUPAC Name | [2-[2-[[5-chloro-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-[1]benzofuro[2,3-f][1,3]benzoxazol-1-yl]methanesulfonic acid |
| SMILES | CCC(=Cc1sc2ccc(Cl)cc2[n+]1CS(=O)(=O)O)C=C1Oc2cc3c(cc2N1CS(=O)(=O)O)oc1ccccc13 |
| InChI | InChI=1S/C27H21ClN2O8S3/c1-2-16(10-27-30(15-41(34,35)36)21-11-17(28)7-8-25(21)39-27)9-26-29(14-40(31,32)33)20-13-23-19(12-24(20)38-26)18-5-3-4-6-22(18)37-23/h3-13H,2,14-15H2,1H3,(H-,31,32,33,34,35,36)/p+1 |
| InChIKey | GCGCKWMEPUVUCN-UHFFFAOYSA-O |
| XLogP | 5.97 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.13 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|