C36H27N2O9S2+ — CID 59044413
1-[2-[2-[[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-[1]benzofuro[2,3-f][1,3]benzoxazol-1-yl]buta-1,2,3-triene-1-sulfonic acid (PubChem CID 59044413) has the molecular formula C36H27N2O9S2+ and a molecular weight of 695.75 g/mol. Its IUPAC name is 1-[2-[2-[[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-[1]benzofuro[2,3-f][1,3]benzoxazol-1-yl]buta-1,2,3-triene-1-sulfonic acid.
| Compound Name | 1-[2-[2-[[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-[1]benzofuro[2,3-f][1,3]benzoxazol-1-yl]buta-1,2,3-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 59044413 |
| Molecular Formula | C36H27N2O9S2+ |
| Molecular Weight | 695.75 g/mol |
| Exact Mass | 695.12 |
| IUPAC Name | 1-[2-[2-[[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-[1]benzofuro[2,3-f][1,3]benzoxazol-1-yl]buta-1,2,3-triene-1-sulfonic acid |
| SMILES | C=C=C=C(N1C(=CC(=Cc2oc3ccc(-c4ccccc4)cc3[n+]2CS(=O)(=O)O)CC)Oc2cc3c(cc21)oc1ccccc13)S(=O)(=O)O |
| InChI | InChI=1S/C36H26N2O9S2/c1-3-10-36(49(42,43)44)38-29-21-32-27(26-13-8-9-14-30(26)45-32)20-33(29)47-35(38)18-23(4-2)17-34-37(22-48(39,40)41)28-19-25(15-16-31(28)46-34)24-11-6-5-7-12-24/h5-9,11-21H,1,4,22H2,2H3,(H-,39,40,41,42,43,44)/p+1 |
| InChIKey | BFHJFUKIOGZFCP-UHFFFAOYSA-O |
| XLogP | 7.34 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.75 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|