C21H21N2O2+ — CID 123589720
2-[3-(3-methyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-3-propan-2-yl-1,3-benzoxazole (PubChem CID 123589720) has the molecular formula C21H21N2O2+ and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[3-(3-methyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-3-propan-2-yl-1,3-benzoxazole.
| Compound Name | 2-[3-(3-methyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-3-propan-2-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 123589720 |
| Molecular Formula | C21H21N2O2+ |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[3-(3-methyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-3-propan-2-yl-1,3-benzoxazole |
| SMILES | CC(C)N1C(=CC=Cc2oc3ccccc3[n+]2C)Oc2ccccc21 |
| InChI | InChI=1S/C21H21N2O2/c1-15(2)23-17-10-5-7-12-19(17)25-21(23)14-8-13-20-22(3)16-9-4-6-11-18(16)24-20/h4-15H,1-3H3/q+1 |
| InChIKey | VMERTPQQNFFMKT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|