C20H22N3O5S- — CID 3116942
3-[2-[2-[3-(2-hydroxyethyl)-5-oxo-1-propyl-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]-1,3-benzoxazol-3-yl]propanoate (PubChem CID 3116942) has the molecular formula C20H22N3O5S- and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-[2-[2-[3-(2-hydroxyethyl)-5-oxo-1-propyl-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]-1,3-benzoxazol-3-yl]propanoate.
| Compound Name | 3-[2-[2-[3-(2-hydroxyethyl)-5-oxo-1-propyl-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]-1,3-benzoxazol-3-yl]propanoate |
|---|---|
| PubChem CID | 3116942 |
| Molecular Formula | C20H22N3O5S- |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-[2-[2-[3-(2-hydroxyethyl)-5-oxo-1-propyl-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]-1,3-benzoxazol-3-yl]propanoate |
| SMILES | CCCN1C(=O)C(=CC=C2Oc3ccccc3N2CCC(=O)[O-])N(CCO)C1=S |
| InChI | InChI=1S/C20H23N3O5S/c1-2-10-23-19(27)15(22(12-13-24)20(23)29)7-8-17-21(11-9-18(25)26)14-5-3-4-6-16(14)28-17/h3-8,24H,2,9-13H2,1H3,(H,25,26)/p-1 |
| InChIKey | MLOUQZCXEHRJSD-UHFFFAOYSA-M |
| XLogP | 0.58 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|