C12H11NO4 — CID 84817962
(2Z)-2-(4-ethyl-2-oxo-1,4-benzoxazin-3-ylidene)acetic acid (PubChem CID 84817962) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is (2Z)-2-(4-ethyl-2-oxo-1,4-benzoxazin-3-ylidene)acetic acid.
| Compound Name | (2Z)-2-(4-ethyl-2-oxo-1,4-benzoxazin-3-ylidene)acetic acid |
|---|---|
| PubChem CID | 84817962 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (2Z)-2-(4-ethyl-2-oxo-1,4-benzoxazin-3-ylidene)acetic acid |
| SMILES | CCN1/C(=C\C(=O)O)C(=O)Oc2ccccc21 |
| InChI | InChI=1S/C12H11NO4/c1-2-13-8-5-3-4-6-10(8)17-12(16)9(13)7-11(14)15/h3-7H,2H2,1H3,(H,14,15)/b9-7- |
| InChIKey | MSRLZTLBLPIDFI-CLFYSBASSA-N |
| XLogP | 1.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|