C23H21NO3S — CID 59360298
(2Z)-2-[1-(benzenesulfonyl)propylidene]-3-benzyl-1,3-benzoxazole (PubChem CID 59360298) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is (2Z)-2-[1-(benzenesulfonyl)propylidene]-3-benzyl-1,3-benzoxazole.
| Compound Name | (2Z)-2-[1-(benzenesulfonyl)propylidene]-3-benzyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 59360298 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (2Z)-2-[1-(benzenesulfonyl)propylidene]-3-benzyl-1,3-benzoxazole |
| SMILES | CC/C(=C1/Oc2ccccc2N1Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21NO3S/c1-2-22(28(25,26)19-13-7-4-8-14-19)23-24(17-18-11-5-3-6-12-18)20-15-9-10-16-21(20)27-23/h3-16H,2,17H2,1H3/b23-22- |
| InChIKey | ZRDZSPYTJFAFDB-FCQUAONHSA-N |
| XLogP | 5.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |