C17H17NO4S — CID 95917189
4-benzyl-6-ethylsulfonyl-1,4-benzoxazin-3-one (PubChem CID 95917189) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is 4-benzyl-6-ethylsulfonyl-1,4-benzoxazin-3-one.
| Compound Name | 4-benzyl-6-ethylsulfonyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 95917189 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 4-benzyl-6-ethylsulfonyl-1,4-benzoxazin-3-one |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)N(Cc1ccccc1)C(=O)CO2 |
| InChI | InChI=1S/C17H17NO4S/c1-2-23(20,21)14-8-9-16-15(10-14)18(17(19)12-22-16)11-13-6-4-3-5-7-13/h3-10H,2,11-12H2,1H3 |
| InChIKey | ATFIBFMOHKXFMO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |