C11H12ClNO4S — CID 82025528
3-oxo-4-propyl-1,4-benzoxazine-6-sulfonyl chloride (PubChem CID 82025528) has the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. Its IUPAC name is 3-oxo-4-propyl-1,4-benzoxazine-6-sulfonyl chloride.
| Compound Name | 3-oxo-4-propyl-1,4-benzoxazine-6-sulfonyl chloride |
|---|---|
| PubChem CID | 82025528 |
| Molecular Formula | C11H12ClNO4S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 3-oxo-4-propyl-1,4-benzoxazine-6-sulfonyl chloride |
| SMILES | CCCN1C(=O)COc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C11H12ClNO4S/c1-2-5-13-9-6-8(18(12,15)16)3-4-10(9)17-7-11(13)14/h3-4,6H,2,5,7H2,1H3 |
| InChIKey | FQIACQPDSDAPRM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |