C27H22N2O3S — CID 102247948
N-(10-benzylphenoxazin-3-yl)-4-ethenylbenzenesulfonamide (PubChem CID 102247948) has the molecular formula C27H22N2O3S and a molecular weight of 454.55 g/mol. Its IUPAC name is N-(10-benzylphenoxazin-3-yl)-4-ethenylbenzenesulfonamide.
| Compound Name | N-(10-benzylphenoxazin-3-yl)-4-ethenylbenzenesulfonamide |
|---|---|
| PubChem CID | 102247948 |
| Molecular Formula | C27H22N2O3S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-(10-benzylphenoxazin-3-yl)-4-ethenylbenzenesulfonamide |
| SMILES | C=Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)Oc2ccccc2N3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N2O3S/c1-2-20-12-15-23(16-13-20)33(30,31)28-22-14-17-25-27(18-22)32-26-11-7-6-10-24(26)29(25)19-21-8-4-3-5-9-21/h2-18,28H,1,19H2 |
| InChIKey | WKCZBKJFGUCAFU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |