C22H19N3O5S — CID 16927385
N-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-4-nitrobenzenesulfonamide (PubChem CID 16927385) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is N-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-4-nitrobenzenesulfonamide.
| Compound Name | N-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 16927385 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-4-nitrobenzenesulfonamide |
| SMILES | O=C1CCc2cc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)ccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C22H19N3O5S/c26-22-13-6-17-14-18(7-12-21(17)24(22)15-16-4-2-1-3-5-16)23-31(29,30)20-10-8-19(9-11-20)25(27)28/h1-5,7-12,14,23H,6,13,15H2 |
| InChIKey | RXLZOPHZPOTURP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|