C25H26N4O3S — CID 18366884
4-[3-[6-(benzenesulfonamido)-2-oxo-3,4-dihydroquinolin-1-yl]propyl]benzenecarboximidamide (PubChem CID 18366884) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 4-[3-[6-(benzenesulfonamido)-2-oxo-3,4-dihydroquinolin-1-yl]propyl]benzenecarboximidamide.
| Compound Name | 4-[3-[6-(benzenesulfonamido)-2-oxo-3,4-dihydroquinolin-1-yl]propyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 18366884 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4-[3-[6-(benzenesulfonamido)-2-oxo-3,4-dihydroquinolin-1-yl]propyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCCN2C(=O)CCc3cc(NS(=O)(=O)c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C25H26N4O3S/c26-25(27)19-10-8-18(9-11-19)5-4-16-29-23-14-13-21(17-20(23)12-15-24(29)30)28-33(31,32)22-6-2-1-3-7-22/h1-3,6-11,13-14,17,28H,4-5,12,15-16H2,(H3,26,27) |
| InChIKey | FNODZOLLVVCYHM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|