C28H33IN4O3S — CID 18366877
4-[3-oxo-3-[6-[(2,4,6-trimethylphenyl)sulfonylamino]-3,4-dihydro-2H-quinolin-1-yl]propyl]benzenecarboximidamide;hydroiodide (PubChem CID 18366877) has the molecular formula C28H33IN4O3S and a molecular weight of 632.57 g/mol. Its IUPAC name is 4-[3-oxo-3-[6-[(2,4,6-trimethylphenyl)sulfonylamino]-3,4-dihydro-2H-quinolin-1-yl]propyl]benzenecarboximidamide;hydroiodide.
| Compound Name | 4-[3-oxo-3-[6-[(2,4,6-trimethylphenyl)sulfonylamino]-3,4-dihydro-2H-quinolin-1-yl]propyl]benzenecarboximidamide;hydroiodide |
|---|---|
| PubChem CID | 18366877 |
| Molecular Formula | C28H33IN4O3S |
| Molecular Weight | 632.57 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | 4-[3-oxo-3-[6-[(2,4,6-trimethylphenyl)sulfonylamino]-3,4-dihydro-2H-quinolin-1-yl]propyl]benzenecarboximidamide;hydroiodide |
| SMILES | I.[H]/N=C(\N)c1ccc(CCC(=O)N2CCCc3cc(NS(=O)(=O)c4c(C)cc(C)cc4C)ccc32)cc1 |
| InChI | InChI=1S/C28H32N4O3S.HI/c1-18-15-19(2)27(20(3)16-18)36(34,35)31-24-11-12-25-23(17-24)5-4-14-32(25)26(33)13-8-21-6-9-22(10-7-21)28(29)30;/h6-7,9-12,15-17,31H,4-5,8,13-14H2,1-3H3,(H3,29,30);1H |
| InChIKey | ZYZBEDPWTMZVOW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|