C42H42N4O7S — CID 173232862
methyl 4-[1-[[1-[3-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]propanoyl]-3,4-dihydro-2H-quinolin-6-yl]sulfamoyl]naphthalen-2-yl]butanoate (PubChem CID 173232862) has the molecular formula C42H42N4O7S and a molecular weight of 746.89 g/mol. Its IUPAC name is methyl 4-[1-[[1-[3-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]propanoyl]-3,4-dihydro-2H-quinolin-6-yl]sulfamoyl]naphthalen-2-yl]butanoate.
| Compound Name | methyl 4-[1-[[1-[3-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]propanoyl]-3,4-dihydro-2H-quinolin-6-yl]sulfamoyl]naphthalen-2-yl]butanoate |
|---|---|
| PubChem CID | 173232862 |
| Molecular Formula | C42H42N4O7S |
| Molecular Weight | 746.89 g/mol |
| Exact Mass | 746.28 |
| IUPAC Name | methyl 4-[1-[[1-[3-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]propanoyl]-3,4-dihydro-2H-quinolin-6-yl]sulfamoyl]naphthalen-2-yl]butanoate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc(CCC(=O)N2CCCc3cc(NS(=O)(=O)c4c(CCCC(=O)OC)ccc5ccccc45)ccc32)cc1 |
| InChI | InChI=1S/C42H42N4O7S/c1-52-39(48)15-7-12-32-22-21-31-11-5-6-14-36(31)40(32)54(50,51)45-35-23-24-37-34(27-35)13-8-26-46(37)38(47)25-18-29-16-19-33(20-17-29)41(43)44-42(49)53-28-30-9-3-2-4-10-30/h2-6,9-11,14,16-17,19-24,27,45H,7-8,12-13,15,18,25-26,28H2,1H3,(H2,43,44,49) |
| InChIKey | GVJAKSDRGZGRQG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 154.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.89 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|