C29H33N4O5S+ — CID 54523027
benzenesulfonyl-[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]-ethoxycarbonyl-methylazanium (PubChem CID 54523027) has the molecular formula C29H33N4O5S+ and a molecular weight of 549.67 g/mol. Its IUPAC name is benzenesulfonyl-[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]-ethoxycarbonyl-methylazanium.
| Compound Name | benzenesulfonyl-[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]-ethoxycarbonyl-methylazanium |
|---|---|
| PubChem CID | 54523027 |
| Molecular Formula | C29H33N4O5S+ |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | benzenesulfonyl-[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]-ethoxycarbonyl-methylazanium |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)N2CCCc3cc([N+](C)(C(=O)OCC)S(=O)(=O)c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C29H33N4O5S/c1-3-38-29(35)33(2,39(36,37)25-9-5-4-6-10-25)24-16-17-26-23(20-24)8-7-19-32(26)27(34)18-13-21-11-14-22(15-12-21)28(30)31/h4-6,9-12,14-17,20H,3,7-8,13,18-19H2,1-2H3,(H3,30,31)/q+1 |
| InChIKey | GJCIPQSBALPUNH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 130.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|